C13H27NO2 — CID 165444344
2-amino-1-(3-methoxy-3-methylbutyl)-4-methylcyclohexan-1-ol (PubChem CID 165444344) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-amino-1-(3-methoxy-3-methylbutyl)-4-methylcyclohexan-1-ol.
| Compound Name | 2-amino-1-(3-methoxy-3-methylbutyl)-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 165444344 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-amino-1-(3-methoxy-3-methylbutyl)-4-methylcyclohexan-1-ol |
| SMILES | COC(C)(C)CCC1(O)CCC(C)CC1N |
| InChI | InChI=1S/C13H27NO2/c1-10-5-6-13(15,11(14)9-10)8-7-12(2,3)16-4/h10-11,15H,5-9,14H2,1-4H3 |
| InChIKey | HJXROQUBFPVBNV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |