C21H26N4O3S — CID 16544439
7-tert-butyl-1,3-dimethyl-5-[2-(4-methylphenoxy)ethylsulfanyl]pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 16544439) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 7-tert-butyl-1,3-dimethyl-5-[2-(4-methylphenoxy)ethylsulfanyl]pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 7-tert-butyl-1,3-dimethyl-5-[2-(4-methylphenoxy)ethylsulfanyl]pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16544439 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 7-tert-butyl-1,3-dimethyl-5-[2-(4-methylphenoxy)ethylsulfanyl]pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(OCCSc2nc(C(C)(C)C)nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-13-7-9-14(10-8-13)28-11-12-29-17-15-16(22-19(23-17)21(2,3)4)24(5)20(27)25(6)18(15)26/h7-10H,11-12H2,1-6H3 |
| InChIKey | MXXRRZDGEWCFQQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|