About N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide
N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide (PubChem CID 165444505) has the molecular formula C8H18F2N2O2S
and a molecular weight of 244.31 g/mol. Its IUPAC name is N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide |
| PubChem CID | 165444505 |
| Molecular Formula | C8H18F2N2O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCC(C)(N)C(F)F |
| InChI | InChI=1S/C8H18F2N2O2S/c1-3-6-15(13,14)12-5-4-8(2,11)7(9)10/h7,12H,3-6,11H2,1-2H3 |
| InChIKey | RJXIPWNPCLWJMJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide?
The IUPAC name of N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide (CID 165444505) is N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide.
What is the SMILES notation for N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide?
The canonical SMILES for N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide is CCCS(=O)(=O)NCCC(C)(N)C(F)F.
What is the InChIKey of N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide?
The InChIKey is RJXIPWNPCLWJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18F2N2O2S/c1-3-6-15(13,14)12-5-4-8(2,11)7(9)10/h7,12H,3-6,11H2,1-2H3.
What are the key properties of N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide?
N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide has a molecular weight of 244.31 g/mol, XLogP of 0.69, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-4,4-difluoro-3-methylbutyl)propane-1-sulfonamide is sourced from PubChem (CID 165444505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).