C8H16Cl3NO — CID 165445160
1,1,1-trichloro-3-(2-methylbutan-2-ylamino)propan-2-ol (PubChem CID 165445160) has the molecular formula C8H16Cl3NO and a molecular weight of 248.58 g/mol. Its IUPAC name is 1,1,1-trichloro-3-(2-methylbutan-2-ylamino)propan-2-ol.
| Compound Name | 1,1,1-trichloro-3-(2-methylbutan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 165445160 |
| Molecular Formula | C8H16Cl3NO |
| Molecular Weight | 248.58 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 1,1,1-trichloro-3-(2-methylbutan-2-ylamino)propan-2-ol |
| SMILES | CCC(C)(C)NCC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H16Cl3NO/c1-4-7(2,3)12-5-6(13)8(9,10)11/h6,12-13H,4-5H2,1-3H3 |
| InChIKey | RFFZKKRSIUXGQG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|