About 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene
4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene (PubChem CID 165446297) has the molecular formula C9H13ClF2
and a molecular weight of 194.65 g/mol. Its IUPAC name is 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene.
Molecular Properties
| Compound Name | 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene |
| PubChem CID | 165446297 |
| Molecular Formula | C9H13ClF2 |
| Molecular Weight | 194.65 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene |
| SMILES | FC(F)CC1(CCl)CC=CCC1 |
| InChI | InChI=1S/C9H13ClF2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-2,8H,3-7H2 |
| InChIKey | ZPJNKFKJVDZJMM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene?
The IUPAC name of 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene (CID 165446297) is 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene.
What is the SMILES notation for 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene?
The canonical SMILES for 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene is FC(F)CC1(CCl)CC=CCC1.
What is the InChIKey of 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene?
The InChIKey is ZPJNKFKJVDZJMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClF2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-2,8H,3-7H2.
What are the key properties of 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene?
4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene has a molecular weight of 194.65 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-4-(2,2-difluoroethyl)cyclohexene is sourced from PubChem (CID 165446297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).