C7H11BrF2O — CID 165446302
3-(bromomethyl)-3-(2,2-difluoroethyl)oxolane (PubChem CID 165446302) has the molecular formula C7H11BrF2O and a molecular weight of 229.06 g/mol. Its IUPAC name is 3-(bromomethyl)-3-(2,2-difluoroethyl)oxolane.
| Compound Name | 3-(bromomethyl)-3-(2,2-difluoroethyl)oxolane |
|---|---|
| PubChem CID | 165446302 |
| Molecular Formula | C7H11BrF2O |
| Molecular Weight | 229.06 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 3-(bromomethyl)-3-(2,2-difluoroethyl)oxolane |
| SMILES | FC(F)CC1(CBr)CCOC1 |
| InChI | InChI=1S/C7H11BrF2O/c8-4-7(3-6(9)10)1-2-11-5-7/h6H,1-5H2 |
| InChIKey | ALMFSFQCUSQUQF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.06 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|