2-aminodecane-1-sulfonyl fluoride

C10H22FNO2S — CID 165446362

IUPAC2-aminodecane-1-sulfonyl fluoride
SMILESCCCCCCCCC(N)CS(=O)(=O)F
InChIInChI=1S/C10H22FNO2S/c1-2-3-4-5-6-7-8-10(12)9-15(11,13)14/h10H,2-9,12H2,1H3
InChIKeyAPUBOKKDBQITQQ-UHFFFAOYSA-N
MW239.36 g/mol
LogP2.36
Rot. Bonds9

About 2-aminodecane-1-sulfonyl fluoride

2-aminodecane-1-sulfonyl fluoride (PubChem CID 165446362) has the molecular formula C10H22FNO2S and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-aminodecane-1-sulfonyl fluoride.

Molecular Properties

Compound Name2-aminodecane-1-sulfonyl fluoride
PubChem CID165446362
Molecular FormulaC10H22FNO2S
Molecular Weight239.36 g/mol
Exact Mass239.14
IUPAC Name2-aminodecane-1-sulfonyl fluoride
SMILESCCCCCCCCC(N)CS(=O)(=O)F
InChIInChI=1S/C10H22FNO2S/c1-2-3-4-5-6-7-8-10(12)9-15(11,13)14/h10H,2-9,12H2,1H3
InChIKeyAPUBOKKDBQITQQ-UHFFFAOYSA-N
XLogP2.36
TPSA60.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.36
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-aminodecane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminodecane-1-sulfonyl fluoride?
The IUPAC name of 2-aminodecane-1-sulfonyl fluoride (CID 165446362) is 2-aminodecane-1-sulfonyl fluoride.
What is the SMILES notation for 2-aminodecane-1-sulfonyl fluoride?
The canonical SMILES for 2-aminodecane-1-sulfonyl fluoride is CCCCCCCCC(N)CS(=O)(=O)F.
What is the InChIKey of 2-aminodecane-1-sulfonyl fluoride?
The InChIKey is APUBOKKDBQITQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22FNO2S/c1-2-3-4-5-6-7-8-10(12)9-15(11,13)14/h10H,2-9,12H2,1H3.
What are the key properties of 2-aminodecane-1-sulfonyl fluoride?
2-aminodecane-1-sulfonyl fluoride has a molecular weight of 239.36 g/mol, XLogP of 2.36, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminodecane-1-sulfonyl fluoride is sourced from PubChem (CID 165446362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).