About 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol
2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol (PubChem CID 165447973) has the molecular formula C10H18N4O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol.
Molecular Properties
| Compound Name | 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol |
| PubChem CID | 165447973 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol |
| SMILES | N[C@@H]1CC[C@H](n2cc(COCCO)nn2)C1 |
| InChI | InChI=1S/C10H18N4O2/c11-8-1-2-10(5-8)14-6-9(12-13-14)7-16-4-3-15/h6,8,10,15H,1-5,7,11H2/t8-,10+/m1/s1 |
| InChIKey | AQEINFGFIYEJLO-SCZZXKLOSA-N |
| XLogP | -0.16 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol?
The IUPAC name of 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol (CID 165447973) is 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol.
What is the SMILES notation for 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol?
The canonical SMILES for 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol is N[C@@H]1CC[C@H](n2cc(COCCO)nn2)C1.
What is the InChIKey of 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol?
The InChIKey is AQEINFGFIYEJLO-SCZZXKLOSA-N. The full InChI is InChI=1S/C10H18N4O2/c11-8-1-2-10(5-8)14-6-9(12-13-14)7-16-4-3-15/h6,8,10,15H,1-5,7,11H2/t8-,10+/m1/s1.
What are the key properties of 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol?
2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol has a molecular weight of 226.28 g/mol, XLogP of -0.16, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methoxy]ethanol is sourced from PubChem (CID 165447973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).