C8H18N2O — CID 165448051
2-[[(1S,3R)-3-aminocyclopentyl]methylamino]ethanol (PubChem CID 165448051) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-[[(1S,3R)-3-aminocyclopentyl]methylamino]ethanol.
| Compound Name | 2-[[(1S,3R)-3-aminocyclopentyl]methylamino]ethanol |
|---|---|
| PubChem CID | 165448051 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-[[(1S,3R)-3-aminocyclopentyl]methylamino]ethanol |
| SMILES | N[C@@H]1CC[C@H](CNCCO)C1 |
| InChI | InChI=1S/C8H18N2O/c9-8-2-1-7(5-8)6-10-3-4-11/h7-8,10-11H,1-6,9H2/t7-,8+/m0/s1 |
| InChIKey | RNTCZSSATITOTD-JGVFFNPUSA-N |
| XLogP | -0.30 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|