About 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol
2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 165448191) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol.
Molecular Properties
| Compound Name | 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol |
| PubChem CID | 165448191 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | CCC(O)(CN1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-2-10(16,11(12,13)14)9-15-7-5-3-4-6-8-15/h16H,2-9H2,1H3 |
| InChIKey | VJCDUZRBOVWGPR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol?
The IUPAC name of 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol (CID 165448191) is 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol.
What is the SMILES notation for 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol?
The canonical SMILES for 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol is CCC(O)(CN1CCCCCC1)C(F)(F)F.
What is the InChIKey of 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol?
The InChIKey is VJCDUZRBOVWGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-2-10(16,11(12,13)14)9-15-7-5-3-4-6-8-15/h16H,2-9H2,1H3.
What are the key properties of 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol?
2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol has a molecular weight of 239.28 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-ylmethyl)-1,1,1-trifluorobutan-2-ol is sourced from PubChem (CID 165448191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).