About (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine
(4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine (PubChem CID 165448218) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine |
| PubChem CID | 165448218 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine |
| SMILES | CC(C)(C)c1cn([C@H]2CNOC2)nn1 |
| InChI | InChI=1S/C9H16N4O/c1-9(2,3)8-5-13(12-11-8)7-4-10-14-6-7/h5,7,10H,4,6H2,1-3H3/t7-/m0/s1 |
| InChIKey | WDAVTSNZRLTGQZ-ZETCQYMHSA-N |
| XLogP | 0.65 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine?
The IUPAC name of (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine (CID 165448218) is (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine.
What is the SMILES notation for (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine?
The canonical SMILES for (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine is CC(C)(C)c1cn([C@H]2CNOC2)nn1.
What is the InChIKey of (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine?
The InChIKey is WDAVTSNZRLTGQZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16N4O/c1-9(2,3)8-5-13(12-11-8)7-4-10-14-6-7/h5,7,10H,4,6H2,1-3H3/t7-/m0/s1.
What are the key properties of (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine?
(4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine has a molecular weight of 196.25 g/mol, XLogP of 0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(4-tert-butyltriazol-1-yl)-1,2-oxazolidine is sourced from PubChem (CID 165448218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).