About 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol
3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol (PubChem CID 165448439) has the molecular formula C15H15F3N2O
and a molecular weight of 296.29 g/mol. Its IUPAC name is 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol.
Molecular Properties
| Compound Name | 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol |
| PubChem CID | 165448439 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol |
| SMILES | OC(CNCc1ccccc1)(c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O/c16-15(17,18)14(21,13-7-4-8-19-10-13)11-20-9-12-5-2-1-3-6-12/h1-8,10,20-21H,9,11H2 |
| InChIKey | RPSREISFWJTBAF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol?
The IUPAC name of 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol (CID 165448439) is 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol.
What is the SMILES notation for 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol?
The canonical SMILES for 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol is OC(CNCc1ccccc1)(c1cccnc1)C(F)(F)F.
What is the InChIKey of 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol?
The InChIKey is RPSREISFWJTBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N2O/c16-15(17,18)14(21,13-7-4-8-19-10-13)11-20-9-12-5-2-1-3-6-12/h1-8,10,20-21H,9,11H2.
What are the key properties of 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol?
3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol has a molecular weight of 296.29 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)-1,1,1-trifluoro-2-pyridin-3-ylpropan-2-ol is sourced from PubChem (CID 165448439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).