C22H21N3O4 — CID 16544882
N-(3-acetylphenyl)-2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetamide (PubChem CID 16544882) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetamide |
|---|---|
| PubChem CID | 16544882 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(3-acetylphenyl)-2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN2C(=O)NC3(CCCc4ccccc43)C2=O)c1 |
| InChI | InChI=1S/C22H21N3O4/c1-14(26)16-7-4-9-17(12-16)23-19(27)13-25-20(28)22(24-21(25)29)11-5-8-15-6-2-3-10-18(15)22/h2-4,6-7,9-10,12H,5,8,11,13H2,1H3,(H,23,27)(H,24,29) |
| InChIKey | SBTBFXCFLCTHRE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|