About 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride
2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride (PubChem CID 165450030) has the molecular formula C9H17Cl2N3O
and a molecular weight of 254.16 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride |
| PubChem CID | 165450030 |
| Molecular Formula | C9H17Cl2N3O |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride |
| SMILES | Cc1nn(C)cc1C1OCCC1N.Cl.Cl |
| InChI | InChI=1S/C9H15N3O.2ClH/c1-6-7(5-12(2)11-6)9-8(10)3-4-13-9;;/h5,8-9H,3-4,10H2,1-2H3;2*1H |
| InChIKey | RJZAAUDJHNBUFV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride?
The IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride (CID 165450030) is 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride.
What is the SMILES notation for 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride?
The canonical SMILES for 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride is Cc1nn(C)cc1C1OCCC1N.Cl.Cl.
What is the InChIKey of 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride?
The InChIKey is RJZAAUDJHNBUFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O.2ClH/c1-6-7(5-12(2)11-6)9-8(10)3-4-13-9;;/h5,8-9H,3-4,10H2,1-2H3;2*1H.
What are the key properties of 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride?
2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride has a molecular weight of 254.16 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride is sourced from PubChem (CID 165450030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).