C9H11FNNaO4S2 — CID 165450115
sodium 2-[(4-fluorophenyl)sulfonyl-methylamino]ethanesulfinate (PubChem CID 165450115) has the molecular formula C9H11FNNaO4S2 and a molecular weight of 303.31 g/mol. Its IUPAC name is sodium 2-[(4-fluorophenyl)sulfonyl-methylamino]ethanesulfinate.
| Compound Name | sodium 2-[(4-fluorophenyl)sulfonyl-methylamino]ethanesulfinate |
|---|---|
| PubChem CID | 165450115 |
| Molecular Formula | C9H11FNNaO4S2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | sodium 2-[(4-fluorophenyl)sulfonyl-methylamino]ethanesulfinate |
| SMILES | CN(CCS(=O)[O-])S(=O)(=O)c1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C9H12FNO4S2.Na/c1-11(6-7-16(12)13)17(14,15)9-4-2-8(10)3-5-9;/h2-5H,6-7H2,1H3,(H,12,13);/q;+1/p-1 |
| InChIKey | YPOWPXBZFGRHGS-UHFFFAOYSA-M |
| XLogP | -2.67 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|