About 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol
3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol (PubChem CID 165450824) has the molecular formula C10H16F3NO
and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol |
| PubChem CID | 165450824 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol |
| SMILES | CC1CC=C(C(O)(CN)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3NO/c1-7-2-4-8(5-3-7)9(15,6-14)10(11,12)13/h4,7,15H,2-3,5-6,14H2,1H3 |
| InChIKey | NQIZPVFQIQEZMW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol?
The IUPAC name of 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol (CID 165450824) is 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol.
What is the SMILES notation for 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol?
The canonical SMILES for 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol is CC1CC=C(C(O)(CN)C(F)(F)F)CC1.
What is the InChIKey of 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol?
The InChIKey is NQIZPVFQIQEZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO/c1-7-2-4-8(5-3-7)9(15,6-14)10(11,12)13/h4,7,15H,2-3,5-6,14H2,1H3.
What are the key properties of 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol?
3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol has a molecular weight of 223.24 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,1,1-trifluoro-2-(4-methylcyclohexen-1-yl)propan-2-ol is sourced from PubChem (CID 165450824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).