About 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol
3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 165450825) has the molecular formula C15H26F3NO
and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 165450825 |
| Molecular Formula | C15H26F3NO |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(/C1=C/CCCCCCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C15H26F3NO/c16-15(17,18)14(20,12-19)13-10-8-6-4-2-1-3-5-7-9-11-13/h10,20H,1-9,11-12,19H2/b13-10+ |
| InChIKey | XEGASUGHLGVRDR-JLHYYAGUSA-N |
| XLogP | 4.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol (CID 165450825) is 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol is NCC(O)(/C1=C/CCCCCCCCCC1)C(F)(F)F.
What is the InChIKey of 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol?
The InChIKey is XEGASUGHLGVRDR-JLHYYAGUSA-N. The full InChI is InChI=1S/C15H26F3NO/c16-15(17,18)14(20,12-19)13-10-8-6-4-2-1-3-5-7-9-11-13/h10,20H,1-9,11-12,19H2/b13-10+.
What are the key properties of 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol?
3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol has a molecular weight of 293.37 g/mol, XLogP of 4.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[(1E)-cyclododecen-1-yl]-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 165450825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).