2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid

C8H13F2NO3 — CID 165451048

IUPAC2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid
SMILESNOC1(CC(=O)O)CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO3/c9-8(10)3-1-7(14-11,2-4-8)5-6(12)13/h1-5,11H2,(H,12,13)
InChIKeyLXHDOZQXXHEGNQ-UHFFFAOYSA-N
MW209.19 g/mol
LogP1.30
Rot. Bonds3

About 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid

2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid (PubChem CID 165451048) has the molecular formula C8H13F2NO3 and a molecular weight of 209.19 g/mol. Its IUPAC name is 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid.

Molecular Properties

Compound Name2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid
PubChem CID165451048
Molecular FormulaC8H13F2NO3
Molecular Weight209.19 g/mol
Exact Mass209.09
IUPAC Name2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid
SMILESNOC1(CC(=O)O)CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO3/c9-8(10)3-1-7(14-11,2-4-8)5-6(12)13/h1-5,11H2,(H,12,13)
InChIKeyLXHDOZQXXHEGNQ-UHFFFAOYSA-N
XLogP1.30
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.19
LogP ≤ 51.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid?
The IUPAC name of 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid (CID 165451048) is 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid.
What is the SMILES notation for 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid?
The canonical SMILES for 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid is NOC1(CC(=O)O)CCC(F)(F)CC1.
What is the InChIKey of 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid?
The InChIKey is LXHDOZQXXHEGNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO3/c9-8(10)3-1-7(14-11,2-4-8)5-6(12)13/h1-5,11H2,(H,12,13).
What are the key properties of 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid?
2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid has a molecular weight of 209.19 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminooxy-4,4-difluorocyclohexyl)acetic acid is sourced from PubChem (CID 165451048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).