C11H12N2O2 — CID 165451129
4-(4-hydroxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one (PubChem CID 165451129) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one.
| Compound Name | 4-(4-hydroxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 165451129 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-(4-hydroxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C)c(=O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C11H12N2O2/c1-7-10(11(15)13(2)12-7)8-3-5-9(14)6-4-8/h3-6,12,14H,1-2H3 |
| InChIKey | FLIZIMYZVBOXCM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |