C8H16N2O — CID 165451437
5-(ethoxymethyl)-1,2,3,6-tetrahydropyridin-3-amine (PubChem CID 165451437) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 5-(ethoxymethyl)-1,2,3,6-tetrahydropyridin-3-amine.
| Compound Name | 5-(ethoxymethyl)-1,2,3,6-tetrahydropyridin-3-amine |
|---|---|
| PubChem CID | 165451437 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 5-(ethoxymethyl)-1,2,3,6-tetrahydropyridin-3-amine |
| SMILES | CCOCC1=CC(N)CNC1 |
| InChI | InChI=1S/C8H16N2O/c1-2-11-6-7-3-8(9)5-10-4-7/h3,8,10H,2,4-6,9H2,1H3 |
| InChIKey | VPVPHDGDYNXYFL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|