About 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide
2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide (PubChem CID 165451740) has the molecular formula C6H8ClNO4
and a molecular weight of 193.59 g/mol. Its IUPAC name is 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide |
| PubChem CID | 165451740 |
| Molecular Formula | C6H8ClNO4 |
| Molecular Weight | 193.59 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide |
| SMILES | O=C(CCl)N[C@@H]1C(=O)OC[C@@H]1O |
| InChI | InChI=1S/C6H8ClNO4/c7-1-4(10)8-5-3(9)2-12-6(5)11/h3,5,9H,1-2H2,(H,8,10)/t3-,5-/m0/s1 |
| InChIKey | BBUFMJHMKSFHLZ-UCORVYFPSA-N |
| XLogP | -1.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.59 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide?
The IUPAC name of 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide (CID 165451740) is 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide.
What is the SMILES notation for 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide?
The canonical SMILES for 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide is O=C(CCl)N[C@@H]1C(=O)OC[C@@H]1O.
What is the InChIKey of 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide?
The InChIKey is BBUFMJHMKSFHLZ-UCORVYFPSA-N. The full InChI is InChI=1S/C6H8ClNO4/c7-1-4(10)8-5-3(9)2-12-6(5)11/h3,5,9H,1-2H2,(H,8,10)/t3-,5-/m0/s1.
What are the key properties of 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide?
2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide has a molecular weight of 193.59 g/mol, XLogP of -1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(3S,4R)-4-hydroxy-2-oxooxolan-3-yl]acetamide is sourced from PubChem (CID 165451740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).