About N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide
N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide (PubChem CID 165451760) has the molecular formula C11H17ClN4O
and a molecular weight of 256.74 g/mol. Its IUPAC name is N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide.
Molecular Properties
| Compound Name | N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide |
| PubChem CID | 165451760 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide |
| SMILES | Cc1nn(C)c(C2CNC2)c1NC(=O)C(C)Cl |
| InChI | InChI=1S/C11H17ClN4O/c1-6(12)11(17)14-9-7(2)15-16(3)10(9)8-4-13-5-8/h6,8,13H,4-5H2,1-3H3,(H,14,17) |
| InChIKey | PIZMVAWBMYCACD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide?
The IUPAC name of N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide (CID 165451760) is N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide.
What is the SMILES notation for N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide?
The canonical SMILES for N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide is Cc1nn(C)c(C2CNC2)c1NC(=O)C(C)Cl.
What is the InChIKey of N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide?
The InChIKey is PIZMVAWBMYCACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN4O/c1-6(12)11(17)14-9-7(2)15-16(3)10(9)8-4-13-5-8/h6,8,13H,4-5H2,1-3H3,(H,14,17).
What are the key properties of N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide?
N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide has a molecular weight of 256.74 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(azetidin-3-yl)-1,3-dimethylpyrazol-4-yl]-2-chloropropanamide is sourced from PubChem (CID 165451760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).