C7H12ClNO — CID 165452270
3-chloro-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 165452270) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is 3-chloro-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-chloro-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 165452270 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3-chloro-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | COCC1=CC(Cl)CNC1 |
| InChI | InChI=1S/C7H12ClNO/c1-10-5-6-2-7(8)4-9-3-6/h2,7,9H,3-5H2,1H3 |
| InChIKey | LDPIEVSUNOIBPB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|