C9H13ClN4 — CID 165452363
3-chloro-5-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,2,3,6-tetrahydropyridine (PubChem CID 165452363) has the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. Its IUPAC name is 3-chloro-5-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-chloro-5-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 165452363 |
| Molecular Formula | C9H13ClN4 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-chloro-5-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,2,3,6-tetrahydropyridine |
| SMILES | Cn1cnnc1CC1=CC(Cl)CNC1 |
| InChI | InChI=1S/C9H13ClN4/c1-14-6-12-13-9(14)3-7-2-8(10)5-11-4-7/h2,6,8,11H,3-5H2,1H3 |
| InChIKey | VPILICIMYXCOHS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|