C7H13NO2 — CID 165452380
5-(methoxymethyl)-1,2,3,6-tetrahydropyridin-3-ol (PubChem CID 165452380) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,2,3,6-tetrahydropyridin-3-ol.
| Compound Name | 5-(methoxymethyl)-1,2,3,6-tetrahydropyridin-3-ol |
|---|---|
| PubChem CID | 165452380 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 5-(methoxymethyl)-1,2,3,6-tetrahydropyridin-3-ol |
| SMILES | COCC1=CC(O)CNC1 |
| InChI | InChI=1S/C7H13NO2/c1-10-5-6-2-7(9)4-8-3-6/h2,7-9H,3-5H2,1H3 |
| InChIKey | YTENVASYMYAUSN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|