About 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride
2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride (PubChem CID 165452655) has the molecular formula C7H7FN2O3S2
and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride.
Molecular Properties
| Compound Name | 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride |
| PubChem CID | 165452655 |
| Molecular Formula | C7H7FN2O3S2 |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride |
| SMILES | O=C(Nc1ncc(S(=O)(=O)F)s1)C1CC1 |
| InChI | InChI=1S/C7H7FN2O3S2/c8-15(12,13)5-3-9-7(14-5)10-6(11)4-1-2-4/h3-4H,1-2H2,(H,9,10,11) |
| InChIKey | CDVFTYXOZWAGEN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride?
The IUPAC name of 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride (CID 165452655) is 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride.
What is the SMILES notation for 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride?
The canonical SMILES for 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride is O=C(Nc1ncc(S(=O)(=O)F)s1)C1CC1.
What is the InChIKey of 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride?
The InChIKey is CDVFTYXOZWAGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O3S2/c8-15(12,13)5-3-9-7(14-5)10-6(11)4-1-2-4/h3-4H,1-2H2,(H,9,10,11).
What are the key properties of 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride?
2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride has a molecular weight of 250.28 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropanecarbonylamino)-1,3-thiazole-5-sulfonyl fluoride is sourced from PubChem (CID 165452655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).