(1-fluorocyclopropyl)methanesulfonyl fluoride

C4H6F2O2S — CID 165452669

IUPAC(1-fluorocyclopropyl)methanesulfonyl fluoride
SMILESO=S(=O)(F)CC1(F)CC1
InChIInChI=1S/C4H6F2O2S/c5-4(1-2-4)3-9(6,7)8/h1-3H2
InChIKeyJNPCMFQLVONDSK-UHFFFAOYSA-N
MW156.15 g/mol
LogP0.79
Rot. Bonds2

About (1-fluorocyclopropyl)methanesulfonyl fluoride

(1-fluorocyclopropyl)methanesulfonyl fluoride (PubChem CID 165452669) has the molecular formula C4H6F2O2S and a molecular weight of 156.15 g/mol. Its IUPAC name is (1-fluorocyclopropyl)methanesulfonyl fluoride.

Molecular Properties

Compound Name(1-fluorocyclopropyl)methanesulfonyl fluoride
PubChem CID165452669
Molecular FormulaC4H6F2O2S
Molecular Weight156.15 g/mol
Exact Mass156.01
IUPAC Name(1-fluorocyclopropyl)methanesulfonyl fluoride
SMILESO=S(=O)(F)CC1(F)CC1
InChIInChI=1S/C4H6F2O2S/c5-4(1-2-4)3-9(6,7)8/h1-3H2
InChIKeyJNPCMFQLVONDSK-UHFFFAOYSA-N
XLogP0.79
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.15
LogP ≤ 50.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (1-fluorocyclopropyl)methanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Butanesulfonyl fluoride, 4-fluoro-
CID 12616
(2,2-Difluorocyclopropyl)methanesulfonyl chloride
CID 55279478
Cyclopropylmethanesulfonyl fluoride
CID 115011326
(1-Fluorocyclopropyl)methanesulfonyl chloride
CID 125424445
2,2-Difluorocyclopropane-1-sulfonyl fluoride
CID 131222362
2-Methylcyclopropane-1-sulfonyl fluoride
CID 139363295
(2,2-Difluorocyclopropyl)methanesulfinate
CID 140533695
(1-Fluorocyclopropyl)methanesulfinate
CID 175085409
2-Fluoro-2-methylpropane-1-sulfonyl fluoride
CID 85914074
(2,2-Difluoro-1-methylcyclopropyl)methanesulfonyl fluoride
CID 165459368
[1-(Difluoromethyl)cyclopropyl]methanesulfonyl fluoride
CID 165459729
[1-(Trifluoromethyl)cyclopropyl]methanesulfonyl fluoride
CID 165460919

Frequently Asked Questions

What is the IUPAC name of (1-fluorocyclopropyl)methanesulfonyl fluoride?
The IUPAC name of (1-fluorocyclopropyl)methanesulfonyl fluoride (CID 165452669) is (1-fluorocyclopropyl)methanesulfonyl fluoride.
What is the SMILES notation for (1-fluorocyclopropyl)methanesulfonyl fluoride?
The canonical SMILES for (1-fluorocyclopropyl)methanesulfonyl fluoride is O=S(=O)(F)CC1(F)CC1.
What is the InChIKey of (1-fluorocyclopropyl)methanesulfonyl fluoride?
The InChIKey is JNPCMFQLVONDSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2O2S/c5-4(1-2-4)3-9(6,7)8/h1-3H2.
What are the key properties of (1-fluorocyclopropyl)methanesulfonyl fluoride?
(1-fluorocyclopropyl)methanesulfonyl fluoride has a molecular weight of 156.15 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluorocyclopropyl)methanesulfonyl fluoride is sourced from PubChem (CID 165452669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).