C14H11N3O3 — CID 165453183
ethyl 3-cyano-2-oxo-6-pyridin-4-yl-1H-pyridine-4-carboxylate (PubChem CID 165453183) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is ethyl 3-cyano-2-oxo-6-pyridin-4-yl-1H-pyridine-4-carboxylate.
| Compound Name | ethyl 3-cyano-2-oxo-6-pyridin-4-yl-1H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 165453183 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | ethyl 3-cyano-2-oxo-6-pyridin-4-yl-1H-pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccncc2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C14H11N3O3/c1-2-20-14(19)10-7-12(9-3-5-16-6-4-9)17-13(18)11(10)8-15/h3-7H,2H2,1H3,(H,17,18) |
| InChIKey | OGYKLTNOVXTGKK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |