About 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one
3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one (PubChem CID 165453258) has the molecular formula C10H8F2N2O
and a molecular weight of 210.18 g/mol. Its IUPAC name is 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one |
| PubChem CID | 165453258 |
| Molecular Formula | C10H8F2N2O |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one |
| SMILES | NCc1cc2c(F)cc(F)cc2[nH]c1=O |
| InChI | InChI=1S/C10H8F2N2O/c11-6-2-8(12)7-1-5(4-13)10(15)14-9(7)3-6/h1-3H,4,13H2,(H,14,15) |
| InChIKey | MLBXVFDJGJZMKN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one?
The IUPAC name of 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one (CID 165453258) is 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one.
What is the SMILES notation for 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one?
The canonical SMILES for 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one is NCc1cc2c(F)cc(F)cc2[nH]c1=O.
What is the InChIKey of 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one?
The InChIKey is MLBXVFDJGJZMKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N2O/c11-6-2-8(12)7-1-5(4-13)10(15)14-9(7)3-6/h1-3H,4,13H2,(H,14,15).
What are the key properties of 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one?
3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one has a molecular weight of 210.18 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-5,7-difluoro-1H-quinolin-2-one is sourced from PubChem (CID 165453258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).