2-chloro-1,3-thiazole-5-sulfonyl fluoride

C3HClFNO2S2 — CID 165453591

IUPAC2-chloro-1,3-thiazole-5-sulfonyl fluoride
SMILESO=S(=O)(F)c1cnc(Cl)s1
InChIInChI=1S/C3HClFNO2S2/c4-3-6-1-2(9-3)10(5,7)8/h1H
InChIKeyOOWVYDSDNDFNMF-UHFFFAOYSA-N
MW201.63 g/mol
LogP1.45
Rot. Bonds1

About 2-chloro-1,3-thiazole-5-sulfonyl fluoride

2-chloro-1,3-thiazole-5-sulfonyl fluoride (PubChem CID 165453591) has the molecular formula C3HClFNO2S2 and a molecular weight of 201.63 g/mol. Its IUPAC name is 2-chloro-1,3-thiazole-5-sulfonyl fluoride.

Molecular Properties

Compound Name2-chloro-1,3-thiazole-5-sulfonyl fluoride
PubChem CID165453591
Molecular FormulaC3HClFNO2S2
Molecular Weight201.63 g/mol
Exact Mass200.91
IUPAC Name2-chloro-1,3-thiazole-5-sulfonyl fluoride
SMILESO=S(=O)(F)c1cnc(Cl)s1
InChIInChI=1S/C3HClFNO2S2/c4-3-6-1-2(9-3)10(5,7)8/h1H
InChIKeyOOWVYDSDNDFNMF-UHFFFAOYSA-N
XLogP1.45
TPSA47.03 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.63
LogP ≤ 51.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-chloro-1,3-thiazole-5-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-1,3-thiazole-5-sulfonyl fluoride?
The IUPAC name of 2-chloro-1,3-thiazole-5-sulfonyl fluoride (CID 165453591) is 2-chloro-1,3-thiazole-5-sulfonyl fluoride.
What is the SMILES notation for 2-chloro-1,3-thiazole-5-sulfonyl fluoride?
The canonical SMILES for 2-chloro-1,3-thiazole-5-sulfonyl fluoride is O=S(=O)(F)c1cnc(Cl)s1.
What is the InChIKey of 2-chloro-1,3-thiazole-5-sulfonyl fluoride?
The InChIKey is OOWVYDSDNDFNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HClFNO2S2/c4-3-6-1-2(9-3)10(5,7)8/h1H.
What are the key properties of 2-chloro-1,3-thiazole-5-sulfonyl fluoride?
2-chloro-1,3-thiazole-5-sulfonyl fluoride has a molecular weight of 201.63 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-thiazole-5-sulfonyl fluoride is sourced from PubChem (CID 165453591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).