C10H9FN2O2S — CID 165453860
1-(4-fluorophenyl)-5-methylpyrazole-4-sulfinic acid (PubChem CID 165453860) has the molecular formula C10H9FN2O2S and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methylpyrazole-4-sulfinic acid.
| Compound Name | 1-(4-fluorophenyl)-5-methylpyrazole-4-sulfinic acid |
|---|---|
| PubChem CID | 165453860 |
| Molecular Formula | C10H9FN2O2S |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methylpyrazole-4-sulfinic acid |
| SMILES | Cc1c(S(=O)O)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FN2O2S/c1-7-10(16(14)15)6-12-13(7)9-4-2-8(11)3-5-9/h2-6H,1H3,(H,14,15) |
| InChIKey | LEZPQPQEMKPWEZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|