About 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid
4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid (PubChem CID 165455310) has the molecular formula C4H4ClNO3S
and a molecular weight of 181.60 g/mol. Its IUPAC name is 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid.
Molecular Properties
| Compound Name | 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid |
| PubChem CID | 165455310 |
| Molecular Formula | C4H4ClNO3S |
| Molecular Weight | 181.60 g/mol |
| Exact Mass | 180.96 |
| IUPAC Name | 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid |
| SMILES | Cc1noc(S(=O)O)c1Cl |
| InChI | InChI=1S/C4H4ClNO3S/c1-2-3(5)4(9-6-2)10(7)8/h1H3,(H,7,8) |
| InChIKey | KTPDETBAAIBQLX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.60 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid?
The IUPAC name of 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid (CID 165455310) is 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid.
What is the SMILES notation for 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid?
The canonical SMILES for 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid is Cc1noc(S(=O)O)c1Cl.
What is the InChIKey of 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid?
The InChIKey is KTPDETBAAIBQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClNO3S/c1-2-3(5)4(9-6-2)10(7)8/h1H3,(H,7,8).
What are the key properties of 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid?
4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid has a molecular weight of 181.60 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methyl-1,2-oxazole-5-sulfinic acid is sourced from PubChem (CID 165455310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).