About disodium;2-iodo-3-methyl-5-sulfinatobenzoate
disodium;2-iodo-3-methyl-5-sulfinatobenzoate (PubChem CID 165455409) has the molecular formula C8H5INa2O4S
and a molecular weight of 370.08 g/mol. Its IUPAC name is disodium;2-iodo-3-methyl-5-sulfinatobenzoate.
Molecular Properties
| Compound Name | disodium;2-iodo-3-methyl-5-sulfinatobenzoate |
| PubChem CID | 165455409 |
| Molecular Formula | C8H5INa2O4S |
| Molecular Weight | 370.08 g/mol |
| Exact Mass | 369.87 |
| IUPAC Name | disodium;2-iodo-3-methyl-5-sulfinatobenzoate |
| SMILES | Cc1cc(S(=O)[O-])cc(C(=O)[O-])c1I.[Na+].[Na+] |
| InChI | InChI=1S/C8H7IO4S.2Na/c1-4-2-5(14(12)13)3-6(7(4)9)8(10)11;;/h2-3H,1H3,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | WFDNSDKBTKBQNN-UHFFFAOYSA-L |
| XLogP | -5.79 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.08 |
| LogP ≤ 5 | -5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-iodo-3-methyl-5-sulfinatobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-iodo-3-methyl-5-sulfinatobenzoate?
The IUPAC name of disodium;2-iodo-3-methyl-5-sulfinatobenzoate (CID 165455409) is disodium;2-iodo-3-methyl-5-sulfinatobenzoate.
What is the SMILES notation for disodium;2-iodo-3-methyl-5-sulfinatobenzoate?
The canonical SMILES for disodium;2-iodo-3-methyl-5-sulfinatobenzoate is Cc1cc(S(=O)[O-])cc(C(=O)[O-])c1I.[Na+].[Na+].
What is the InChIKey of disodium;2-iodo-3-methyl-5-sulfinatobenzoate?
The InChIKey is WFDNSDKBTKBQNN-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H7IO4S.2Na/c1-4-2-5(14(12)13)3-6(7(4)9)8(10)11;;/h2-3H,1H3,(H,10,11)(H,12,13);;/q;2*+1/p-2.
What are the key properties of disodium;2-iodo-3-methyl-5-sulfinatobenzoate?
disodium;2-iodo-3-methyl-5-sulfinatobenzoate has a molecular weight of 370.08 g/mol, XLogP of -5.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-iodo-3-methyl-5-sulfinatobenzoate is sourced from PubChem (CID 165455409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).