C10H14N2OS — CID 165456178
5-[2-(1,2-thiazol-5-yl)ethyl]-1,2,3,6-tetrahydropyridin-3-ol (PubChem CID 165456178) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 5-[2-(1,2-thiazol-5-yl)ethyl]-1,2,3,6-tetrahydropyridin-3-ol.
| Compound Name | 5-[2-(1,2-thiazol-5-yl)ethyl]-1,2,3,6-tetrahydropyridin-3-ol |
|---|---|
| PubChem CID | 165456178 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-[2-(1,2-thiazol-5-yl)ethyl]-1,2,3,6-tetrahydropyridin-3-ol |
| SMILES | OC1C=C(CCc2ccns2)CNC1 |
| InChI | InChI=1S/C10H14N2OS/c13-9-5-8(6-11-7-9)1-2-10-3-4-12-14-10/h3-5,9,11,13H,1-2,6-7H2 |
| InChIKey | IBJMLWGOPGBAIH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|