C13H18N2 — CID 165456524
5-[(4-methylphenyl)methyl]-1,2,3,6-tetrahydropyridin-3-amine (PubChem CID 165456524) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methyl]-1,2,3,6-tetrahydropyridin-3-amine.
| Compound Name | 5-[(4-methylphenyl)methyl]-1,2,3,6-tetrahydropyridin-3-amine |
|---|---|
| PubChem CID | 165456524 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 5-[(4-methylphenyl)methyl]-1,2,3,6-tetrahydropyridin-3-amine |
| SMILES | Cc1ccc(CC2=CC(N)CNC2)cc1 |
| InChI | InChI=1S/C13H18N2/c1-10-2-4-11(5-3-10)6-12-7-13(14)9-15-8-12/h2-5,7,13,15H,6,8-9,14H2,1H3 |
| InChIKey | SGCOZPMJOITQSW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|