About 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde
4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde (PubChem CID 165456748) has the molecular formula C12H10BrNOS
and a molecular weight of 296.19 g/mol. Its IUPAC name is 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde |
| PubChem CID | 165456748 |
| Molecular Formula | C12H10BrNOS |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(-c2nc(Br)cs2)c(C)cc1C=O |
| InChI | InChI=1S/C12H10BrNOS/c1-7-4-10(8(2)3-9(7)5-15)12-14-11(13)6-16-12/h3-6H,1-2H3 |
| InChIKey | TXQLIFPTRWMHQP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde?
The IUPAC name of 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde (CID 165456748) is 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde.
What is the SMILES notation for 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde?
The canonical SMILES for 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde is Cc1cc(-c2nc(Br)cs2)c(C)cc1C=O.
What is the InChIKey of 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde?
The InChIKey is TXQLIFPTRWMHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNOS/c1-7-4-10(8(2)3-9(7)5-15)12-14-11(13)6-16-12/h3-6H,1-2H3.
What are the key properties of 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde?
4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde has a molecular weight of 296.19 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethylbenzaldehyde is sourced from PubChem (CID 165456748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).