About [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride
[6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride (PubChem CID 165456784) has the molecular formula C8H11ClF2N2O
and a molecular weight of 224.64 g/mol. Its IUPAC name is [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride |
| PubChem CID | 165456784 |
| Molecular Formula | C8H11ClF2N2O |
| Molecular Weight | 224.64 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cccc(OCC(F)F)n1 |
| InChI | InChI=1S/C8H10F2N2O.ClH/c9-7(10)5-13-8-3-1-2-6(4-11)12-8;/h1-3,7H,4-5,11H2;1H |
| InChIKey | VDLCDEIANQONNP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.64 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride?
The IUPAC name of [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride (CID 165456784) is [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride.
What is the SMILES notation for [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride?
The canonical SMILES for [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride is Cl.NCc1cccc(OCC(F)F)n1.
What is the InChIKey of [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride?
The InChIKey is VDLCDEIANQONNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O.ClH/c9-7(10)5-13-8-3-1-2-6(4-11)12-8;/h1-3,7H,4-5,11H2;1H.
What are the key properties of [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride?
[6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride has a molecular weight of 224.64 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,2-difluoroethoxy)-2-pyridinyl]methanamine;hydrochloride is sourced from PubChem (CID 165456784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).