C14H24F3NO — CID 165457519
3-amino-1,1,1-trifluoro-2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]propan-2-ol (PubChem CID 165457519) has the molecular formula C14H24F3NO and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]propan-2-ol.
| Compound Name | 3-amino-1,1,1-trifluoro-2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 165457519 |
| Molecular Formula | C14H24F3NO |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]propan-2-ol |
| SMILES | CCC(C)(C)C1CC=C(C(O)(CN)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F3NO/c1-4-12(2,3)10-5-7-11(8-6-10)13(19,9-18)14(15,16)17/h7,10,19H,4-6,8-9,18H2,1-3H3 |
| InChIKey | AEPFIVFDMYWAHU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|