C13H22F3NO — CID 165457810
3-amino-1,1,1-trifluoro-2-(3,3,5,5-tetramethylcyclohexen-1-yl)propan-2-ol (PubChem CID 165457810) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(3,3,5,5-tetramethylcyclohexen-1-yl)propan-2-ol.
| Compound Name | 3-amino-1,1,1-trifluoro-2-(3,3,5,5-tetramethylcyclohexen-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 165457810 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(3,3,5,5-tetramethylcyclohexen-1-yl)propan-2-ol |
| SMILES | CC1(C)C=C(C(O)(CN)C(F)(F)F)CC(C)(C)C1 |
| InChI | InChI=1S/C13H22F3NO/c1-10(2)5-9(6-11(3,4)7-10)12(18,8-17)13(14,15)16/h5,18H,6-8,17H2,1-4H3 |
| InChIKey | PXNSOADQUNQMEF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|