C9H12F5NO — CID 165457812
3-amino-2-(4,4-difluorocyclohexen-1-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 165457812) has the molecular formula C9H12F5NO and a molecular weight of 245.19 g/mol. Its IUPAC name is 3-amino-2-(4,4-difluorocyclohexen-1-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-(4,4-difluorocyclohexen-1-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 165457812 |
| Molecular Formula | C9H12F5NO |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-amino-2-(4,4-difluorocyclohexen-1-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(C1=CCC(F)(F)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H12F5NO/c10-7(11)3-1-6(2-4-7)8(16,5-15)9(12,13)14/h1,16H,2-5,15H2 |
| InChIKey | YPQHPXYPHLGQKI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|