About 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one
1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one (PubChem CID 165457972) has the molecular formula C14H19BrN2O2
and a molecular weight of 327.22 g/mol. Its IUPAC name is 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one |
| PubChem CID | 165457972 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCOc2c(CN)cc(Br)cc2C1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-9(2)14(18)17-3-4-19-13-10(7-16)5-12(15)6-11(13)8-17/h5-6,9H,3-4,7-8,16H2,1-2H3 |
| InChIKey | OGLZBQZKNUBJCI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one?
The IUPAC name of 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one (CID 165457972) is 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one.
What is the SMILES notation for 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one?
The canonical SMILES for 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one is CC(C)C(=O)N1CCOc2c(CN)cc(Br)cc2C1.
What is the InChIKey of 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one?
The InChIKey is OGLZBQZKNUBJCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN2O2/c1-9(2)14(18)17-3-4-19-13-10(7-16)5-12(15)6-11(13)8-17/h5-6,9H,3-4,7-8,16H2,1-2H3.
What are the key properties of 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one?
1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one has a molecular weight of 327.22 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[9-(aminomethyl)-7-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one is sourced from PubChem (CID 165457972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).