C12H20BrNO3S — CID 165458218
5-bromo-N-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)pentanamide (PubChem CID 165458218) has the molecular formula C12H20BrNO3S and a molecular weight of 338.27 g/mol. Its IUPAC name is 5-bromo-N-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)pentanamide.
| Compound Name | 5-bromo-N-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)pentanamide |
|---|---|
| PubChem CID | 165458218 |
| Molecular Formula | C12H20BrNO3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 5-bromo-N-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)pentanamide |
| SMILES | O=C(CCCCBr)NC1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C12H20BrNO3S/c13-6-2-1-3-12(15)14-9-7-10-4-5-11(8-9)18(10,16)17/h9-11H,1-8H2,(H,14,15) |
| InChIKey | ANUKTFZJKHLXEL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|