C8H14N6 — CID 165458390
5-[(1-methyltetrazol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-3-amine (PubChem CID 165458390) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is 5-[(1-methyltetrazol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-3-amine.
| Compound Name | 5-[(1-methyltetrazol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-3-amine |
|---|---|
| PubChem CID | 165458390 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 5-[(1-methyltetrazol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-3-amine |
| SMILES | Cn1nnnc1CC1=CC(N)CNC1 |
| InChI | InChI=1S/C8H14N6/c1-14-8(11-12-13-14)3-6-2-7(9)5-10-4-6/h2,7,10H,3-5,9H2,1H3 |
| InChIKey | RQTVPSIDVAIJMU-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|