About 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride
2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride (PubChem CID 165459367) has the molecular formula C7H4FNO3S2
and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride.
Molecular Properties
| Compound Name | 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride |
| PubChem CID | 165459367 |
| Molecular Formula | C7H4FNO3S2 |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)F)cc2s1 |
| InChI | InChI=1S/C7H4FNO3S2/c8-14(11,12)4-1-2-5-6(3-4)13-7(10)9-5/h1-3H,(H,9,10) |
| InChIKey | KXMGPVOZCINTIZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride?
The IUPAC name of 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride (CID 165459367) is 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride.
What is the SMILES notation for 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride?
The canonical SMILES for 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride is O=c1[nH]c2ccc(S(=O)(=O)F)cc2s1.
What is the InChIKey of 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride?
The InChIKey is KXMGPVOZCINTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO3S2/c8-14(11,12)4-1-2-5-6(3-4)13-7(10)9-5/h1-3H,(H,9,10).
What are the key properties of 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride?
2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride has a molecular weight of 233.25 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3H-1,3-benzothiazole-6-sulfonyl fluoride is sourced from PubChem (CID 165459367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).