About 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid
3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid (PubChem CID 165459487) has the molecular formula C26H22F2N2O5
and a molecular weight of 480.47 g/mol. Its IUPAC name is 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid.
Molecular Properties
| Compound Name | 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid |
| PubChem CID | 165459487 |
| Molecular Formula | C26H22F2N2O5 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid |
| SMILES | O=C(NCc1ccc(C(=O)NCC(F)(F)C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H22F2N2O5/c27-26(28,24(32)33)15-30-23(31)17-11-9-16(10-12-17)13-29-25(34)35-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22H,13-15H2,(H,29,34)(H,30,31)(H,32,33) |
| InChIKey | WPPQMBWYSCDPDY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid?
The IUPAC name of 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid (CID 165459487) is 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid.
What is the SMILES notation for 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid?
The canonical SMILES for 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid is O=C(NCc1ccc(C(=O)NCC(F)(F)C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid?
The InChIKey is WPPQMBWYSCDPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22F2N2O5/c27-26(28,24(32)33)15-30-23(31)17-11-9-16(10-12-17)13-29-25(34)35-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22H,13-15H2,(H,29,34)(H,30,31)(H,32,33).
What are the key properties of 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid?
3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid has a molecular weight of 480.47 g/mol, XLogP of 4.18, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]amino]-2,2-difluoropropanoic acid is sourced from PubChem (CID 165459487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).