C11H11F2NO — CID 165459758
5-(2,3-difluorophenyl)-1,2,3,6-tetrahydropyridin-3-ol (PubChem CID 165459758) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-1,2,3,6-tetrahydropyridin-3-ol.
| Compound Name | 5-(2,3-difluorophenyl)-1,2,3,6-tetrahydropyridin-3-ol |
|---|---|
| PubChem CID | 165459758 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-(2,3-difluorophenyl)-1,2,3,6-tetrahydropyridin-3-ol |
| SMILES | OC1C=C(c2cccc(F)c2F)CNC1 |
| InChI | InChI=1S/C11H11F2NO/c12-10-3-1-2-9(11(10)13)7-4-8(15)6-14-5-7/h1-4,8,14-15H,5-6H2 |
| InChIKey | KTWONUPVYOYUAK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |