About (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride
(4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride (PubChem CID 165459788) has the molecular formula C5H7FN2O4S
and a molecular weight of 210.19 g/mol. Its IUPAC name is (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride.
Molecular Properties
| Compound Name | (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride |
| PubChem CID | 165459788 |
| Molecular Formula | C5H7FN2O4S |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride |
| SMILES | CC1(CS(=O)(=O)F)NC(=O)NC1=O |
| InChI | InChI=1S/C5H7FN2O4S/c1-5(2-13(6,11)12)3(9)7-4(10)8-5/h2H2,1H3,(H2,7,8,9,10) |
| InChIKey | BTBKBQIVBAZKAU-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride?
The IUPAC name of (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride (CID 165459788) is (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride.
What is the SMILES notation for (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride?
The canonical SMILES for (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride is CC1(CS(=O)(=O)F)NC(=O)NC1=O.
What is the InChIKey of (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride?
The InChIKey is BTBKBQIVBAZKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2O4S/c1-5(2-13(6,11)12)3(9)7-4(10)8-5/h2H2,1H3,(H2,7,8,9,10).
What are the key properties of (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride?
(4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride has a molecular weight of 210.19 g/mol, XLogP of -1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl fluoride is sourced from PubChem (CID 165459788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).