C11H20N2O4S — CID 165460067
1-[4a-(aminomethyl)-1,1-dioxo-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-2-methoxyethanone (PubChem CID 165460067) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-[4a-(aminomethyl)-1,1-dioxo-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-2-methoxyethanone.
| Compound Name | 1-[4a-(aminomethyl)-1,1-dioxo-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 165460067 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[4a-(aminomethyl)-1,1-dioxo-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC2C(CN)(CCCS2(=O)=O)C1 |
| InChI | InChI=1S/C11H20N2O4S/c1-17-6-10(14)13-5-9-11(7-12,8-13)3-2-4-18(9,15)16/h9H,2-8,12H2,1H3 |
| InChIKey | SYQCATDCPUCSKX-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |