6-chloro-7-hydroxyquinoline-4-carboxylic acid

C10H6ClNO3 — CID 165460215

IUPAC6-chloro-7-hydroxyquinoline-4-carboxylic acid
SMILESO=C(O)c1ccnc2cc(O)c(Cl)cc12
InChIInChI=1S/C10H6ClNO3/c11-7-3-6-5(10(14)15)1-2-12-8(6)4-9(7)13/h1-4,13H,(H,14,15)
InChIKeyDGXYHWITDDTEIU-UHFFFAOYSA-N
MW223.62 g/mol
LogP2.29
Rot. Bonds1

About 6-chloro-7-hydroxyquinoline-4-carboxylic acid

6-chloro-7-hydroxyquinoline-4-carboxylic acid (PubChem CID 165460215) has the molecular formula C10H6ClNO3 and a molecular weight of 223.62 g/mol. Its IUPAC name is 6-chloro-7-hydroxyquinoline-4-carboxylic acid.

Molecular Properties

Compound Name6-chloro-7-hydroxyquinoline-4-carboxylic acid
PubChem CID165460215
Molecular FormulaC10H6ClNO3
Molecular Weight223.62 g/mol
Exact Mass223.00
IUPAC Name6-chloro-7-hydroxyquinoline-4-carboxylic acid
SMILESO=C(O)c1ccnc2cc(O)c(Cl)cc12
InChIInChI=1S/C10H6ClNO3/c11-7-3-6-5(10(14)15)1-2-12-8(6)4-9(7)13/h1-4,13H,(H,14,15)
InChIKeyDGXYHWITDDTEIU-UHFFFAOYSA-N
XLogP2.29
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.62
LogP ≤ 52.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-chloro-7-hydroxyquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

6-chloro-4-methylquinolin-7-ol
CID 143647672
7-fluoroquinoline-4-carboxylic acid
CID 18475507
6-aminoquinoline-4-carboxylic acid;dihydrochloride
CID 171397441
6-(2-chlorophenoxy)quinoline-4-carboxylic acid
CID 102941682
5,7-dichloro-6-fluoroquinoline-4-carboxylic acid
CID 107584360
6-ethylquinoline-4-carboxylic acid
CID 83527113
4-(7-chloroquinolin-4-yl)-2-hydroxybenzoic acid
CID 167888725
azane;6-methoxyquinoline-4-carboxylic acid
CID 67151937
sodium;hydride;6-methoxyquinoline-4-carboxylic acid
CID 173088597
1-chloroisoquinoline-5-carboxylic acid
CID 21192483
6-(3-hydroxy-3-methylazetidin-1-yl)quinoline-4-carboxylic acid
CID 164532677
5-chloro-8-hydroxyquinoline-7-carboxylic acid
CID 14534767

Frequently Asked Questions

What is the IUPAC name of 6-chloro-7-hydroxyquinoline-4-carboxylic acid?
The IUPAC name of 6-chloro-7-hydroxyquinoline-4-carboxylic acid (CID 165460215) is 6-chloro-7-hydroxyquinoline-4-carboxylic acid.
What is the SMILES notation for 6-chloro-7-hydroxyquinoline-4-carboxylic acid?
The canonical SMILES for 6-chloro-7-hydroxyquinoline-4-carboxylic acid is O=C(O)c1ccnc2cc(O)c(Cl)cc12.
What is the InChIKey of 6-chloro-7-hydroxyquinoline-4-carboxylic acid?
The InChIKey is DGXYHWITDDTEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO3/c11-7-3-6-5(10(14)15)1-2-12-8(6)4-9(7)13/h1-4,13H,(H,14,15).
What are the key properties of 6-chloro-7-hydroxyquinoline-4-carboxylic acid?
6-chloro-7-hydroxyquinoline-4-carboxylic acid has a molecular weight of 223.62 g/mol, XLogP of 2.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-hydroxyquinoline-4-carboxylic acid is sourced from PubChem (CID 165460215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).