About 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide
2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 16546036) has the molecular formula C22H28N2O4S
and a molecular weight of 416.54 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide |
| PubChem CID | 16546036 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2C)c(C)c1 |
| InChI | InChI=1S/C22H28N2O4S/c1-16-7-10-21(18(3)13-16)28-15-22(25)23-20-14-19(9-8-17(20)2)29(26,27)24-11-5-4-6-12-24/h7-10,13-14H,4-6,11-12,15H2,1-3H3,(H,23,25) |
| InChIKey | PHAWFUKVVRJQMN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide?
The IUPAC name of 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide (CID 16546036) is 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide.
What is the SMILES notation for 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide?
The canonical SMILES for 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide is Cc1ccc(OCC(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2C)c(C)c1.
What is the InChIKey of 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide?
The InChIKey is PHAWFUKVVRJQMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O4S/c1-16-7-10-21(18(3)13-16)28-15-22(25)23-20-14-19(9-8-17(20)2)29(26,27)24-11-5-4-6-12-24/h7-10,13-14H,4-6,11-12,15H2,1-3H3,(H,23,25).
What are the key properties of 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide?
2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide has a molecular weight of 416.54 g/mol, XLogP of 3.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenoxy)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide is sourced from PubChem (CID 16546036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).